C32H32N6O8 — CID 175665284
1-N,4-N-bis[(E)-1-(3-nitrophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide (PubChem CID 175665284) has the molecular formula C32H32N6O8 and a molecular weight of 628.64 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-1-(3-nitrophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(E)-1-(3-nitrophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175665284 |
| Molecular Formula | C32H32N6O8 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 1-N,4-N-bis[(E)-1-(3-nitrophenyl)-3-oxo-3-(propylamino)prop-1-en-2-yl]benzene-1,4-dicarboxamide |
| SMILES | CCCNC(=O)/C(=C\c1cccc([N+](=O)[O-])c1)NC(=O)c1ccc(C(=O)N/C(=C/c2cccc([N+](=O)[O-])c2)C(=O)NCCC)cc1 |
| InChI | InChI=1S/C32H32N6O8/c1-3-15-33-31(41)27(19-21-7-5-9-25(17-21)37(43)44)35-29(39)23-11-13-24(14-12-23)30(40)36-28(32(42)34-16-4-2)20-22-8-6-10-26(18-22)38(45)46/h5-14,17-20H,3-4,15-16H2,1-2H3,(H,33,41)(H,34,42)(H,35,39)(H,36,40)/b27-19+,28-20+ |
| InChIKey | YUZQGZBIQKPFOS-MKYUKRCKSA-N |
| XLogP | 4.10 |
| TPSA | 202.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|