C13H13F3O — CID 175665814
4-(cyclopropylmethoxy)-1-ethenyl-2-(trifluoromethyl)benzene (PubChem CID 175665814) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-1-ethenyl-2-(trifluoromethyl)benzene.
| Compound Name | 4-(cyclopropylmethoxy)-1-ethenyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 175665814 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-(cyclopropylmethoxy)-1-ethenyl-2-(trifluoromethyl)benzene |
| SMILES | C=Cc1ccc(OCC2CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3O/c1-2-10-5-6-11(17-8-9-3-4-9)7-12(10)13(14,15)16/h2,5-7,9H,1,3-4,8H2 |
| InChIKey | VTMFSVOYGCXSPE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |