C32H33N3OS — CID 175666080
2-[[2-[[2-(4-methoxyphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]ethylamino]methyl]-N,N-dimethylpyridin-4-amine (PubChem CID 175666080) has the molecular formula C32H33N3OS and a molecular weight of 507.70 g/mol. Its IUPAC name is 2-[[2-[[2-(4-methoxyphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]ethylamino]methyl]-N,N-dimethylpyridin-4-amine.
| Compound Name | 2-[[2-[[2-(4-methoxyphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]ethylamino]methyl]-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 175666080 |
| Molecular Formula | C32H33N3OS |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 2-[[2-[[2-(4-methoxyphenyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl]sulfanyl]ethylamino]methyl]-N,N-dimethylpyridin-4-amine |
| SMILES | COc1ccc(C2(SCCNCc3cc(N(C)C)ccn3)c3ccccc3C=Cc3ccccc32)cc1 |
| InChI | InChI=1S/C32H33N3OS/c1-35(2)28-18-19-34-27(22-28)23-33-20-21-37-32(26-14-16-29(36-3)17-15-26)30-10-6-4-8-24(30)12-13-25-9-5-7-11-31(25)32/h4-19,22,33H,20-21,23H2,1-3H3 |
| InChIKey | DRYUIKYJZFRVKL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|