C8H12F6O — CID 175666417
1,1,3-trifluoro-4-(2,4,4-trifluorobutoxy)butane (PubChem CID 175666417) has the molecular formula C8H12F6O and a molecular weight of 238.17 g/mol. Its IUPAC name is 1,1,3-trifluoro-4-(2,4,4-trifluorobutoxy)butane.
| Compound Name | 1,1,3-trifluoro-4-(2,4,4-trifluorobutoxy)butane |
|---|---|
| PubChem CID | 175666417 |
| Molecular Formula | C8H12F6O |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1,1,3-trifluoro-4-(2,4,4-trifluorobutoxy)butane |
| SMILES | FC(F)CC(F)COCC(F)CC(F)F |
| InChI | InChI=1S/C8H12F6O/c9-5(1-7(11)12)3-15-4-6(10)2-8(13)14/h5-8H,1-4H2 |
| InChIKey | KHDQBFRHOAFMEV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |