C23H17ClN6O2 — CID 175666521
2-[2-chloro-6-(quinolin-3-ylamino)purin-9-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 175666521) has the molecular formula C23H17ClN6O2 and a molecular weight of 444.88 g/mol. Its IUPAC name is 2-[2-chloro-6-(quinolin-3-ylamino)purin-9-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[2-chloro-6-(quinolin-3-ylamino)purin-9-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 175666521 |
| Molecular Formula | C23H17ClN6O2 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-[2-chloro-6-(quinolin-3-ylamino)purin-9-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2cnc3c(Nc4cnc5ccccc5c4)nc(Cl)nc32)cc1 |
| InChI | InChI=1S/C23H17ClN6O2/c1-32-17-8-6-14(7-9-17)19(31)12-30-13-26-20-21(28-23(24)29-22(20)30)27-16-10-15-4-2-3-5-18(15)25-11-16/h2-11,13H,12H2,1H3,(H,27,28,29) |
| InChIKey | MAVLDOXPVCXPFM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |