C35H30N4OS — CID 175666538
3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 175666538) has the molecular formula C35H30N4OS and a molecular weight of 554.72 g/mol. Its IUPAC name is 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 175666538 |
| Molecular Formula | C35H30N4OS |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 3-[6-(1,3-benzothiazol-2-yl)-9-hexylcarbazol-3-yl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | CCCCCCn1c2ccc(C=C(C#N)C(=O)Nc3ccccc3)cc2c2cc(-c3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C35H30N4OS/c1-2-3-4-10-19-39-31-17-15-24(20-26(23-36)34(40)37-27-11-6-5-7-12-27)21-28(31)29-22-25(16-18-32(29)39)35-38-30-13-8-9-14-33(30)41-35/h5-9,11-18,20-22H,2-4,10,19H2,1H3,(H,37,40) |
| InChIKey | XGLIOUYLPLRAAB-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|