C18H15FN4O3S — CID 175667102
7-(4-fluorophenyl)-12,12-dimethyl-13-oxa-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),5,10(15)-triene-3,8-dione (PubChem CID 175667102) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-12,12-dimethyl-13-oxa-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),5,10(15)-triene-3,8-dione.
| Compound Name | 7-(4-fluorophenyl)-12,12-dimethyl-13-oxa-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),5,10(15)-triene-3,8-dione |
|---|---|
| PubChem CID | 175667102 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 7-(4-fluorophenyl)-12,12-dimethyl-13-oxa-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),5,10(15)-triene-3,8-dione |
| SMILES | CC1(C)Cc2c(sc3c2c(=O)n(-c2ccc(F)cc2)c2n[nH]c(=O)n32)CO1 |
| InChI | InChI=1S/C18H15FN4O3S/c1-18(2)7-11-12(8-26-18)27-15-13(11)14(24)22(10-5-3-9(19)4-6-10)16-20-21-17(25)23(15)16/h3-6H,7-8H2,1-2H3,(H,21,25) |
| InChIKey | NAGLNUDKZJIJLX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |