About cyclohexa-2,4-dien-1-ylideneazanide;nickel
cyclohexa-2,4-dien-1-ylideneazanide;nickel (PubChem CID 175667791) has the molecular formula C6H5NNi
and a molecular weight of 149.81 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylideneazanide;nickel.
Molecular Properties
| Compound Name | cyclohexa-2,4-dien-1-ylideneazanide;nickel |
| PubChem CID | 175667791 |
| Molecular Formula | C6H5NNi |
| Molecular Weight | 149.81 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylideneazanide;nickel |
| SMILES | [N-]=C1C=CC=C[CH+]1.[Ni] |
| InChI | InChI=1S/C6H5N.Ni/c7-6-4-2-1-3-5-6;/h1-5H; |
| InChIKey | FZDWZVCIYMJXNU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 22.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.81 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-dien-1-ylideneazanide;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-dien-1-ylideneazanide;nickel?
The IUPAC name of cyclohexa-2,4-dien-1-ylideneazanide;nickel (CID 175667791) is cyclohexa-2,4-dien-1-ylideneazanide;nickel.
What is the SMILES notation for cyclohexa-2,4-dien-1-ylideneazanide;nickel?
The canonical SMILES for cyclohexa-2,4-dien-1-ylideneazanide;nickel is [N-]=C1C=CC=C[CH+]1.[Ni].
What is the InChIKey of cyclohexa-2,4-dien-1-ylideneazanide;nickel?
The InChIKey is FZDWZVCIYMJXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.Ni/c7-6-4-2-1-3-5-6;/h1-5H;.
What are the key properties of cyclohexa-2,4-dien-1-ylideneazanide;nickel?
cyclohexa-2,4-dien-1-ylideneazanide;nickel has a molecular weight of 149.81 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-dien-1-ylideneazanide;nickel is sourced from PubChem (CID 175667791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).