About CID 175667853
CID 175667853 (PubChem CID 175667853) has the molecular formula C16H15IOPd-
and a molecular weight of 456.62 g/mol.
Molecular Properties
| Compound Name | CID 175667853 |
| PubChem CID | 175667853 |
| Molecular Formula | C16H15IOPd- |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | — |
| SMILES | CC1(Cc2[c]cccc2)COc2ccccc21.[I-].[Pd] |
| InChI | InChI=1S/C16H15O.HI.Pd/c1-16(11-13-7-3-2-4-8-13)12-17-15-10-6-5-9-14(15)16;;/h2-7,9-10H,11-12H2,1H3;1H;/p-1 |
| InChIKey | AEICQFAUBOPQEX-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 175667853 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175667853?
The IUPAC name of CID 175667853 (CID 175667853) is not available.
What is the SMILES notation for CID 175667853?
The canonical SMILES for CID 175667853 is CC1(Cc2[c]cccc2)COc2ccccc21.[I-].[Pd].
What is the InChIKey of CID 175667853?
The InChIKey is AEICQFAUBOPQEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H15O.HI.Pd/c1-16(11-13-7-3-2-4-8-13)12-17-15-10-6-5-9-14(15)16;;/h2-7,9-10H,11-12H2,1H3;1H;/p-1.
What are the key properties of CID 175667853?
CID 175667853 has a molecular weight of 456.62 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175667853 is sourced from PubChem (CID 175667853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).