About [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol
[1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol (PubChem CID 175667958) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol |
| PubChem CID | 175667958 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol |
| SMILES | OCC1(Nc2ncnc3[nH]ccc23)CCC1 |
| InChI | InChI=1S/C11H14N4O/c16-6-11(3-1-4-11)15-10-8-2-5-12-9(8)13-7-14-10/h2,5,7,16H,1,3-4,6H2,(H2,12,13,14,15) |
| InChIKey | VIJTZDMICNLQTB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol?
The IUPAC name of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol (CID 175667958) is [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol.
What is the SMILES notation for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol?
The canonical SMILES for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol is OCC1(Nc2ncnc3[nH]ccc23)CCC1.
What is the InChIKey of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol?
The InChIKey is VIJTZDMICNLQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c16-6-11(3-1-4-11)15-10-8-2-5-12-9(8)13-7-14-10/h2,5,7,16H,1,3-4,6H2,(H2,12,13,14,15).
What are the key properties of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol?
[1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol has a molecular weight of 218.26 g/mol, XLogP of 1.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclobutyl]methanol is sourced from PubChem (CID 175667958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).