About [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol
[1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol (PubChem CID 175667978) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol |
| PubChem CID | 175667978 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol |
| SMILES | OCC1(Nc2ncnc3[nH]ccc23)CCCC1 |
| InChI | InChI=1S/C12H16N4O/c17-7-12(4-1-2-5-12)16-11-9-3-6-13-10(9)14-8-15-11/h3,6,8,17H,1-2,4-5,7H2,(H2,13,14,15,16) |
| InChIKey | WBNKWKYRGAWNJC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The IUPAC name of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol (CID 175667978) is [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol.
What is the SMILES notation for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The canonical SMILES for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol is OCC1(Nc2ncnc3[nH]ccc23)CCCC1.
What is the InChIKey of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol?
The InChIKey is WBNKWKYRGAWNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c17-7-12(4-1-2-5-12)16-11-9-3-6-13-10(9)14-8-15-11/h3,6,8,17H,1-2,4-5,7H2,(H2,13,14,15,16).
What are the key properties of [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol?
[1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol has a molecular weight of 232.29 g/mol, XLogP of 1.67, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)cyclopentyl]methanol is sourced from PubChem (CID 175667978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).