About magnesium;cyclohexane;hydroxymethanone
magnesium;cyclohexane;hydroxymethanone (PubChem CID 175668097) has the molecular formula C7H12MgO2
and a molecular weight of 152.48 g/mol. Its IUPAC name is magnesium;cyclohexane;hydroxymethanone.
Molecular Properties
| Compound Name | magnesium;cyclohexane;hydroxymethanone |
| PubChem CID | 175668097 |
| Molecular Formula | C7H12MgO2 |
| Molecular Weight | 152.48 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | magnesium;cyclohexane;hydroxymethanone |
| SMILES | O=[C-]O.[CH-]1CCCCC1.[Mg+2] |
| InChI | InChI=1S/C6H11.CHO2.Mg/c1-2-4-6-5-3-1;2-1-3;/h1H,2-6H2;(H,2,3);/q2*-1;+2 |
| InChIKey | QFWCOBZLGSBTLP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;cyclohexane;hydroxymethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;cyclohexane;hydroxymethanone?
The IUPAC name of magnesium;cyclohexane;hydroxymethanone (CID 175668097) is magnesium;cyclohexane;hydroxymethanone.
What is the SMILES notation for magnesium;cyclohexane;hydroxymethanone?
The canonical SMILES for magnesium;cyclohexane;hydroxymethanone is O=[C-]O.[CH-]1CCCCC1.[Mg+2].
What is the InChIKey of magnesium;cyclohexane;hydroxymethanone?
The InChIKey is QFWCOBZLGSBTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11.CHO2.Mg/c1-2-4-6-5-3-1;2-1-3;/h1H,2-6H2;(H,2,3);/q2*-1;+2.
What are the key properties of magnesium;cyclohexane;hydroxymethanone?
magnesium;cyclohexane;hydroxymethanone has a molecular weight of 152.48 g/mol, XLogP of 1.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;cyclohexane;hydroxymethanone is sourced from PubChem (CID 175668097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).