C33H33N5O8 — CID 175668211
methyl 5-[[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 175668211) has the molecular formula C33H33N5O8 and a molecular weight of 627.65 g/mol. Its IUPAC name is methyl 5-[[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 5-[[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 175668211 |
| Molecular Formula | C33H33N5O8 |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | methyl 5-[[4-[4-[[(6aS)-2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxy]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(NC(=O)c3cc(NC(=O)CCCOc4cc5c(cc4OC)C(=O)N4CCC[C@H]4C=N5)cn3C)ccc2o1 |
| InChI | InChI=1S/C33H33N5O8/c1-37-18-21(14-25(37)31(40)36-20-8-9-26-19(12-20)13-29(46-26)33(42)44-3)35-30(39)7-5-11-45-28-16-24-23(15-27(28)43-2)32(41)38-10-4-6-22(38)17-34-24/h8-9,12-18,22H,4-7,10-11H2,1-3H3,(H,35,39)(H,36,40)/t22-/m0/s1 |
| InChIKey | AVQSVEFLULNDQS-QFIPXVFZSA-N |
| XLogP | 4.94 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|