About 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine
3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine (PubChem CID 175668720) has the molecular formula C8H4Br2F6N2
and a molecular weight of 401.93 g/mol. Its IUPAC name is 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine |
| PubChem CID | 175668720 |
| Molecular Formula | C8H4Br2F6N2 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 399.86 |
| IUPAC Name | 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1c(N)c(Br)c(C(F)(F)F)c(C(F)(F)F)c1Br |
| InChI | InChI=1S/C8H4Br2F6N2/c9-3-1(7(11,12)13)2(8(14,15)16)4(10)6(18)5(3)17/h17-18H2 |
| InChIKey | LOUFXROJZPLSJU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine?
The IUPAC name of 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine (CID 175668720) is 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine.
What is the SMILES notation for 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine?
The canonical SMILES for 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine is Nc1c(N)c(Br)c(C(F)(F)F)c(C(F)(F)F)c1Br.
What is the InChIKey of 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine?
The InChIKey is LOUFXROJZPLSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Br2F6N2/c9-3-1(7(11,12)13)2(8(14,15)16)4(10)6(18)5(3)17/h17-18H2.
What are the key properties of 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine?
3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine has a molecular weight of 401.93 g/mol, XLogP of 4.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromo-4,5-bis(trifluoromethyl)benzene-1,2-diamine is sourced from PubChem (CID 175668720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).