C39H33F3N8O7 — CID 175670529
9-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-10-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione (PubChem CID 175670529) has the molecular formula C39H33F3N8O7 and a molecular weight of 782.74 g/mol. Its IUPAC name is 9-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-10-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione.
| Compound Name | 9-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-10-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione |
|---|---|
| PubChem CID | 175670529 |
| Molecular Formula | C39H33F3N8O7 |
| Molecular Weight | 782.74 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | 9-[4-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]hexanoyl]piperazin-1-yl]-10-(trifluoromethyl)pyrido[3,2-b]phenazine-5,12-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCC(=O)N4CCN(c5ccc6nc7c(nc6c5C(F)(F)F)C(=O)c5ncccc5C7=O)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H33F3N8O7/c40-39(41,42)29-24(11-10-23-31(29)47-33-32(45-23)34(53)21-7-5-15-44-30(21)35(33)54)48-16-18-49(19-17-48)27(52)9-2-1-3-14-43-22-8-4-6-20-28(22)38(57)50(37(20)56)25-12-13-26(51)46-36(25)55/h4-8,10-11,15,25,43H,1-3,9,12-14,16-19H2,(H,46,51,55) |
| InChIKey | MASAEDKLWIKSCF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|