About 4-fluoropyridine-2,6-dicarbonitrile
4-fluoropyridine-2,6-dicarbonitrile (PubChem CID 175672759) has the molecular formula C7H2FN3
and a molecular weight of 147.11 g/mol. Its IUPAC name is 4-fluoropyridine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 4-fluoropyridine-2,6-dicarbonitrile |
| PubChem CID | 175672759 |
| Molecular Formula | C7H2FN3 |
| Molecular Weight | 147.11 g/mol |
| Exact Mass | 147.02 |
| IUPAC Name | 4-fluoropyridine-2,6-dicarbonitrile |
| SMILES | N#Cc1cc(F)cc(C#N)n1 |
| InChI | InChI=1S/C7H2FN3/c8-5-1-6(3-9)11-7(2-5)4-10/h1-2H |
| InChIKey | OYXYUVMEIMAJAW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.11 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluoropyridine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyridine-2,6-dicarbonitrile?
The IUPAC name of 4-fluoropyridine-2,6-dicarbonitrile (CID 175672759) is 4-fluoropyridine-2,6-dicarbonitrile.
What is the SMILES notation for 4-fluoropyridine-2,6-dicarbonitrile?
The canonical SMILES for 4-fluoropyridine-2,6-dicarbonitrile is N#Cc1cc(F)cc(C#N)n1.
What is the InChIKey of 4-fluoropyridine-2,6-dicarbonitrile?
The InChIKey is OYXYUVMEIMAJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2FN3/c8-5-1-6(3-9)11-7(2-5)4-10/h1-2H.
What are the key properties of 4-fluoropyridine-2,6-dicarbonitrile?
4-fluoropyridine-2,6-dicarbonitrile has a molecular weight of 147.11 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyridine-2,6-dicarbonitrile is sourced from PubChem (CID 175672759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).