About 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea
3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 175672830) has the molecular formula C13H17F2N3O2
and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea.
Molecular Properties
| Compound Name | 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea |
| PubChem CID | 175672830 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | C[C@@H](c1ccncc1)N(C)C(=O)N[C@H]1COCC1(F)F |
| InChI | InChI=1S/C13H17F2N3O2/c1-9(10-3-5-16-6-4-10)18(2)12(19)17-11-7-20-8-13(11,14)15/h3-6,9,11H,7-8H2,1-2H3,(H,17,19)/t9-,11-/m0/s1 |
| InChIKey | BDCYNMOBTJPEHV-ONGXEEELSA-N |
| XLogP | 1.82 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea?
The IUPAC name of 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea (CID 175672830) is 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea.
What is the SMILES notation for 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea?
The canonical SMILES for 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea is C[C@@H](c1ccncc1)N(C)C(=O)N[C@H]1COCC1(F)F.
What is the InChIKey of 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea?
The InChIKey is BDCYNMOBTJPEHV-ONGXEEELSA-N. The full InChI is InChI=1S/C13H17F2N3O2/c1-9(10-3-5-16-6-4-10)18(2)12(19)17-11-7-20-8-13(11,14)15/h3-6,9,11H,7-8H2,1-2H3,(H,17,19)/t9-,11-/m0/s1.
What are the key properties of 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea?
3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea has a molecular weight of 285.29 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3S)-4,4-difluorooxolan-3-yl]-1-methyl-1-[(1S)-1-pyridin-4-ylethyl]urea is sourced from PubChem (CID 175672830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).