About tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane
tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane (PubChem CID 175672908) has the molecular formula C21H44O2Sn
and a molecular weight of 447.29 g/mol. Its IUPAC name is tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane.
Molecular Properties
| Compound Name | tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane |
| PubChem CID | 175672908 |
| Molecular Formula | C21H44O2Sn |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane |
| SMILES | C=C(CC(OCC)OCC)C[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H17O2.3C4H9.Sn/c1-5-10-9(11-6-2)7-8(3)4;3*1-3-4-2;/h9H,3-7H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | CAWZMCKREYGHHF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane?
The IUPAC name of tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane (CID 175672908) is tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane.
What is the SMILES notation for tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane?
The canonical SMILES for tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane is C=C(CC(OCC)OCC)C[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane?
The InChIKey is CAWZMCKREYGHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O2.3C4H9.Sn/c1-5-10-9(11-6-2)7-8(3)4;3*1-3-4-2;/h9H,3-7H2,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane?
tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane has a molecular weight of 447.29 g/mol, XLogP of 7.18, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(4,4-diethoxy-2-methylidenebutyl)stannane is sourced from PubChem (CID 175672908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).