C20H40O4Si — CID 175672917
(1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3-methylpentan-1-ol (PubChem CID 175672917) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is (1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3-methylpentan-1-ol.
| Compound Name | (1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 175672917 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (1R,3S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3-methylpentan-1-ol |
| SMILES | C[C@@H](CCO[Si](C)(C)C(C)(C)C)C[C@@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H40O4Si/c1-16(10-13-23-25(5,6)19(2,3)4)14-17(21)18-15-22-20(24-18)11-8-7-9-12-20/h16-18,21H,7-15H2,1-6H3/t16-,17+,18+/m0/s1 |
| InChIKey | CVMGBELIBLKAQA-RCCFBDPRSA-N |
| XLogP | 4.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|