C21H18N4O6 — CID 175673444
methyl 1-(4-methoxyphenyl)-6-(4-nitrophenyl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate (PubChem CID 175673444) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is methyl 1-(4-methoxyphenyl)-6-(4-nitrophenyl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate.
| Compound Name | methyl 1-(4-methoxyphenyl)-6-(4-nitrophenyl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175673444 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | methyl 1-(4-methoxyphenyl)-6-(4-nitrophenyl)-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(OC)cc2)c2c1CCN(c1ccc([N+](=O)[O-])cc1)C2=O |
| InChI | InChI=1S/C21H18N4O6/c1-30-16-9-7-14(8-10-16)24-19-17(18(22-24)21(27)31-2)11-12-23(20(19)26)13-3-5-15(6-4-13)25(28)29/h3-10H,11-12H2,1-2H3 |
| InChIKey | TXBAJEFCPSXPKT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|