C16H14N6O8S2 — CID 175673620
(6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]-nitrosoamino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 175673620) has the molecular formula C16H14N6O8S2 and a molecular weight of 482.46 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]-nitrosoamino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]-nitrosoamino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 175673620 |
| Molecular Formula | C16H14N6O8S2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]-nitrosoamino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)[C@@H](N(N=O)C(=O)/C(=N\OCC(=O)O)c3csc(N)n3)[C@H]2SC1 |
| InChI | InChI=1S/C16H14N6O8S2/c1-2-6-4-31-14-11(13(26)21(14)10(6)15(27)28)22(20-29)12(25)9(19-30-3-8(23)24)7-5-32-16(17)18-7/h2,5,11,14H,1,3-4H2,(H2,17,18)(H,23,24)(H,27,28)/b19-9-/t11-,14-/m1/s1 |
| InChIKey | HHWKSEKSAZERMK-HDDAFJEHSA-N |
| XLogP | -0.15 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|