C22H34N2O6 — CID 175673937
3-[[[4-[[2-(carboxymethyl)-4-methylpentyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]methyl]-5-methylhexanoic acid (PubChem CID 175673937) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is 3-[[[4-[[2-(carboxymethyl)-4-methylpentyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]methyl]-5-methylhexanoic acid.
| Compound Name | 3-[[[4-[[2-(carboxymethyl)-4-methylpentyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 175673937 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-[[[4-[[2-(carboxymethyl)-4-methylpentyl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]methyl]-5-methylhexanoic acid |
| SMILES | CC(C)CC(CNC1=CC(=O)C(NCC(CC(=O)O)CC(C)C)=CC1=O)CC(=O)O |
| InChI | InChI=1S/C22H34N2O6/c1-13(2)5-15(7-21(27)28)11-23-17-9-20(26)18(10-19(17)25)24-12-16(6-14(3)4)8-22(29)30/h9-10,13-16,23-24H,5-8,11-12H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | KBAAZAIBPZFZQL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|