C13H17N3O6S — CID 175674355
(4aR)-6-[2-(aminomethylideneamino)ethylsulfanyl]-4-[(1R)-1-hydroxyethyl]-1,3-dioxo-4a,5-dihydro-4H-pyrrolo[1,2-c][1,3]oxazine-7-carboxylic acid (PubChem CID 175674355) has the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. Its IUPAC name is (4aR)-6-[2-(aminomethylideneamino)ethylsulfanyl]-4-[(1R)-1-hydroxyethyl]-1,3-dioxo-4a,5-dihydro-4H-pyrrolo[1,2-c][1,3]oxazine-7-carboxylic acid.
| Compound Name | (4aR)-6-[2-(aminomethylideneamino)ethylsulfanyl]-4-[(1R)-1-hydroxyethyl]-1,3-dioxo-4a,5-dihydro-4H-pyrrolo[1,2-c][1,3]oxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 175674355 |
| Molecular Formula | C13H17N3O6S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (4aR)-6-[2-(aminomethylideneamino)ethylsulfanyl]-4-[(1R)-1-hydroxyethyl]-1,3-dioxo-4a,5-dihydro-4H-pyrrolo[1,2-c][1,3]oxazine-7-carboxylic acid |
| SMILES | C[C@@H](O)C1C(=O)OC(=O)N2C(C(=O)O)=C(SCC/N=C/N)C[C@H]12 |
| InChI | InChI=1S/C13H17N3O6S/c1-6(17)9-7-4-8(23-3-2-15-5-14)10(11(18)19)16(7)13(21)22-12(9)20/h5-7,9,17H,2-4H2,1H3,(H2,14,15)(H,18,19)/t6-,7-,9?/m1/s1 |
| InChIKey | RZKMGEJCKQXVQH-UMPGHQJDSA-N |
| XLogP | -0.25 |
| TPSA | 142.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|