C15H26N2O11P2 — CID 175676040
[hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] pentyl hydrogen phosphate (PubChem CID 175676040) has the molecular formula C15H26N2O11P2 and a molecular weight of 472.32 g/mol. Its IUPAC name is [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] pentyl hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] pentyl hydrogen phosphate |
|---|---|
| PubChem CID | 175676040 |
| Molecular Formula | C15H26N2O11P2 |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [hydroxy-[[(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl] pentyl hydrogen phosphate |
| SMILES | CCCCCOP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C15H26N2O11P2/c1-3-4-5-6-25-29(21,22)28-30(23,24)26-9-12-11(18)7-13(27-12)17-8-10(2)14(19)16-15(17)20/h8,11-13,18H,3-7,9H2,1-2H3,(H,21,22)(H,23,24)(H,16,19,20)/t11-,12+,13+/m0/s1 |
| InChIKey | IJERSCZPEJXECM-YNEHKIRRSA-N |
| XLogP | 0.93 |
| TPSA | 186.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|