About [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate
[2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate (PubChem CID 175678283) has the molecular formula C22H30N2O3Se
and a molecular weight of 449.45 g/mol. Its IUPAC name is [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate.
Molecular Properties
| Compound Name | [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate |
| PubChem CID | 175678283 |
| Molecular Formula | C22H30N2O3Se |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)[Se]/C(=N/C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C22H30N2O3Se/c1-16(25)27-20-15-9-8-14-19(20)21(26)28-22(23-17-10-4-2-5-11-17)24-18-12-6-3-7-13-18/h8-9,14-15,17-18H,2-7,10-13H2,1H3,(H,23,24) |
| InChIKey | KXZKSVUVWHBDJF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate?
The IUPAC name of [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate (CID 175678283) is [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate.
What is the SMILES notation for [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate?
The canonical SMILES for [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate is CC(=O)Oc1ccccc1C(=O)[Se]/C(=N/C1CCCCC1)NC1CCCCC1.
What is the InChIKey of [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate?
The InChIKey is KXZKSVUVWHBDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N2O3Se/c1-16(25)27-20-15-9-8-14-19(20)21(26)28-22(23-17-10-4-2-5-11-17)24-18-12-6-3-7-13-18/h8-9,14-15,17-18H,2-7,10-13H2,1H3,(H,23,24).
What are the key properties of [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate?
[2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate has a molecular weight of 449.45 g/mol, XLogP of 4.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N,N'-dicyclohexylcarbamimidoyl)selanylcarbonylphenyl] acetate is sourced from PubChem (CID 175678283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).