About ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate
ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate (PubChem CID 175678458) has the molecular formula C17H36O3Si
and a molecular weight of 316.56 g/mol. Its IUPAC name is ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate.
Molecular Properties
| Compound Name | ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate |
| PubChem CID | 175678458 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate |
| SMILES | CCOC(=O)CC[C@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-9-19-16(18)11-10-14(2)12-15(3)13-20-21(7,8)17(4,5)6/h14-15H,9-13H2,1-8H3/t14-,15-/m0/s1 |
| InChIKey | BZDSCWITYISFTQ-GJZGRUSLSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate?
The IUPAC name of ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate (CID 175678458) is ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate.
What is the SMILES notation for ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate?
The canonical SMILES for ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate is CCOC(=O)CC[C@H](C)C[C@H](C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate?
The InChIKey is BZDSCWITYISFTQ-GJZGRUSLSA-N. The full InChI is InChI=1S/C17H36O3Si/c1-9-19-16(18)11-10-14(2)12-15(3)13-20-21(7,8)17(4,5)6/h14-15H,9-13H2,1-8H3/t14-,15-/m0/s1.
What are the key properties of ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate?
ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate has a molecular weight of 316.56 g/mol, XLogP of 5.01, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S,6S)-7-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylheptanoate is sourced from PubChem (CID 175678458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).