C22H40O4 — CID 175678463
ethyl (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-enoate (PubChem CID 175678463) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is ethyl (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-enoate.
| Compound Name | ethyl (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-enoate |
|---|---|
| PubChem CID | 175678463 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | ethyl (E,4S,6S,8R,10S)-4,6,8,10-tetramethyl-11-(oxan-2-yloxy)undec-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)COC1CCCCO1 |
| InChI | InChI=1S/C22H40O4/c1-6-24-21(23)11-10-17(2)13-18(3)14-19(4)15-20(5)16-26-22-9-7-8-12-25-22/h10-11,17-20,22H,6-9,12-16H2,1-5H3/b11-10+/t17-,18-,19-,20+,22?/m1/s1 |
| InChIKey | IOYLZIGYKHDRLR-RDLMZSCHSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|