C24H26FN3O5 — CID 175678711
4-[[2-[5-(2-fluoro-3-methoxyphenyl)-6-methyl-2,4-dioxo-1H-pyrimidin-3-yl]-1-phenylethyl]amino]butanoic acid (PubChem CID 175678711) has the molecular formula C24H26FN3O5 and a molecular weight of 455.49 g/mol. Its IUPAC name is 4-[[2-[5-(2-fluoro-3-methoxyphenyl)-6-methyl-2,4-dioxo-1H-pyrimidin-3-yl]-1-phenylethyl]amino]butanoic acid.
| Compound Name | 4-[[2-[5-(2-fluoro-3-methoxyphenyl)-6-methyl-2,4-dioxo-1H-pyrimidin-3-yl]-1-phenylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175678711 |
| Molecular Formula | C24H26FN3O5 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[[2-[5-(2-fluoro-3-methoxyphenyl)-6-methyl-2,4-dioxo-1H-pyrimidin-3-yl]-1-phenylethyl]amino]butanoic acid |
| SMILES | COc1cccc(-c2c(C)[nH]c(=O)n(CC(NCCCC(=O)O)c3ccccc3)c2=O)c1F |
| InChI | InChI=1S/C24H26FN3O5/c1-15-21(17-10-6-11-19(33-2)22(17)25)23(31)28(24(32)27-15)14-18(16-8-4-3-5-9-16)26-13-7-12-20(29)30/h3-6,8-11,18,26H,7,12-14H2,1-2H3,(H,27,32)(H,29,30) |
| InChIKey | WSIOIBFWIMLREI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|