C20H39O9P — CID 175679122
[(2R)-3-[hydroxy-[(2S)-2-hydroxypropoxy]phosphoryl]oxy-2-pentanoyloxypropyl] nonanoate (PubChem CID 175679122) has the molecular formula C20H39O9P and a molecular weight of 454.50 g/mol. Its IUPAC name is [(2R)-3-[hydroxy-[(2S)-2-hydroxypropoxy]phosphoryl]oxy-2-pentanoyloxypropyl] nonanoate.
| Compound Name | [(2R)-3-[hydroxy-[(2S)-2-hydroxypropoxy]phosphoryl]oxy-2-pentanoyloxypropyl] nonanoate |
|---|---|
| PubChem CID | 175679122 |
| Molecular Formula | C20H39O9P |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | [(2R)-3-[hydroxy-[(2S)-2-hydroxypropoxy]phosphoryl]oxy-2-pentanoyloxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](C)O)OC(=O)CCCC |
| InChI | InChI=1S/C20H39O9P/c1-4-6-8-9-10-11-13-19(22)26-15-18(29-20(23)12-7-5-2)16-28-30(24,25)27-14-17(3)21/h17-18,21H,4-16H2,1-3H3,(H,24,25)/t17-,18+/m0/s1 |
| InChIKey | QZGTUCTZAHVQGS-ZWKOTPCHSA-N |
| XLogP | 3.90 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|