C23H46NO9P — CID 175679204
[(2R,3S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxy-2-nonanoyloxypropyl] nonanoate (PubChem CID 175679204) has the molecular formula C23H46NO9P and a molecular weight of 511.59 g/mol. Its IUPAC name is [(2R,3S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxy-2-nonanoyloxypropyl] nonanoate.
| Compound Name | [(2R,3S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxy-2-nonanoyloxypropyl] nonanoate |
|---|---|
| PubChem CID | 175679204 |
| Molecular Formula | C23H46NO9P |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | [(2R,3S)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-hydroxy-2-nonanoyloxypropyl] nonanoate |
| SMILES | CCCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCCC)[C@@H](O)OP(=O)(O)OCCN |
| InChI | InChI=1S/C23H46NO9P/c1-3-5-7-9-11-13-15-21(25)30-19-20(23(27)33-34(28,29)31-18-17-24)32-22(26)16-14-12-10-8-6-4-2/h20,23,27H,3-19,24H2,1-2H3,(H,28,29)/t20-,23+/m1/s1 |
| InChIKey | QTVHAPRLQANPMY-OFNKIYASSA-N |
| XLogP | 4.35 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|