About 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one
1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one (PubChem CID 175679333) has the molecular formula C7H11N4OSe
and a molecular weight of 246.15 g/mol.
Molecular Properties
| Compound Name | 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one |
| PubChem CID | 175679333 |
| Molecular Formula | C7H11N4OSe |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | — |
| SMILES | CCN1C(=O)NC2C1N=C([Se])N2C |
| InChI | InChI=1S/C7H11N4OSe/c1-3-11-5-4(8-6(11)12)10(2)7(13)9-5/h4-5H,3H2,1-2H3,(H,8,12) |
| InChIKey | SSQCAKXOPOGIGG-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one?
The IUPAC name of 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one (CID 175679333) is not available.
What is the SMILES notation for 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one?
The canonical SMILES for 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one is CCN1C(=O)NC2C1N=C([Se])N2C.
What is the InChIKey of 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one?
The InChIKey is SSQCAKXOPOGIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N4OSe/c1-3-11-5-4(8-6(11)12)10(2)7(13)9-5/h4-5H,3H2,1-2H3,(H,8,12).
What are the key properties of 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one?
1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one has a molecular weight of 246.15 g/mol, XLogP of -0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methyl-5-selenoxohexahydroimidazo[4,5-d]imidazol-2(1h)-one is sourced from PubChem (CID 175679333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).