C10H19IN4OS — CID 175679344
3-tert-butyl-6-methyl-5-methylsulfanyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazol-6-ium-2-one iodide (PubChem CID 175679344) has the molecular formula C10H19IN4OS and a molecular weight of 370.26 g/mol. Its IUPAC name is 3-tert-butyl-6-methyl-5-methylsulfanyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazol-6-ium-2-one iodide.
| Compound Name | 3-tert-butyl-6-methyl-5-methylsulfanyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazol-6-ium-2-one iodide |
|---|---|
| PubChem CID | 175679344 |
| Molecular Formula | C10H19IN4OS |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-tert-butyl-6-methyl-5-methylsulfanyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazol-6-ium-2-one iodide |
| SMILES | CSC1=[N+](C)C2NC(=O)N(C(C)(C)C)C2N1.[I-] |
| InChI | InChI=1S/C10H18N4OS.HI/c1-10(2,3)14-7-6(11-8(14)15)13(4)9(12-7)16-5;/h6-7H,1-5H3,(H,11,15);1H |
| InChIKey | SSVOCAHWSVTAIJ-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 47.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|