About methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate
methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate (PubChem CID 175679386) has the molecular formula C24H26N2O3
and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate.
Molecular Properties
| Compound Name | methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate |
| PubChem CID | 175679386 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate |
| SMILES | COC(=O)CCCCn1c2c(c3ccccc31)CN(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C24H26N2O3/c1-29-23(27)13-7-8-15-26-21-12-6-5-11-19(21)20-17-25(16-14-22(20)26)24(28)18-9-3-2-4-10-18/h2-6,9-12H,7-8,13-17H2,1H3 |
| InChIKey | GLWSSDMHUXQUGD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate?
The IUPAC name of methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate (CID 175679386) is methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate.
What is the SMILES notation for methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate?
The canonical SMILES for methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate is COC(=O)CCCCn1c2c(c3ccccc31)CN(C(=O)c1ccccc1)CC2.
What is the InChIKey of methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate?
The InChIKey is GLWSSDMHUXQUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O3/c1-29-23(27)13-7-8-15-26-21-12-6-5-11-19(21)20-17-25(16-14-22(20)26)24(28)18-9-3-2-4-10-18/h2-6,9-12H,7-8,13-17H2,1H3.
What are the key properties of methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate?
methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate has a molecular weight of 390.48 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(2-benzoyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)pentanoate is sourced from PubChem (CID 175679386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).