C28H32N4O2S — CID 175679412
N-[[(S)-[(2S,4R,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]carbamothioyl]benzamide (PubChem CID 175679412) has the molecular formula C28H32N4O2S and a molecular weight of 488.66 g/mol. Its IUPAC name is N-[[(S)-[(2S,4R,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]carbamothioyl]benzamide.
| Compound Name | N-[[(S)-[(2S,4R,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 175679412 |
| Molecular Formula | C28H32N4O2S |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[[(S)-[(2S,4R,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]carbamothioyl]benzamide |
| SMILES | CC[C@H]1CN2CC[C@@H]1C[C@H]2[C@@H](NC(=S)NC(=O)c1ccccc1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H32N4O2S/c1-3-18-17-32-14-12-20(18)15-25(32)26(30-28(35)31-27(33)19-7-5-4-6-8-19)22-11-13-29-24-10-9-21(34-2)16-23(22)24/h4-11,13,16,18,20,25-26H,3,12,14-15,17H2,1-2H3,(H2,30,31,33,35)/t18-,20+,25-,26-/m0/s1 |
| InChIKey | BXGVQPDVLSWUAW-YCULYRLHSA-N |
| XLogP | 4.71 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|