C21H24ClFN4O3 — CID 175680061
6-amino-3-[(3R,3'R)-4-chloro-3'-hydroxy-4'-methoxyspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 175680061) has the molecular formula C21H24ClFN4O3 and a molecular weight of 434.90 g/mol. Its IUPAC name is 6-amino-3-[(3R,3'R)-4-chloro-3'-hydroxy-4'-methoxyspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(3R,3'R)-4-chloro-3'-hydroxy-4'-methoxyspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 175680061 |
| Molecular Formula | C21H24ClFN4O3 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 6-amino-3-[(3R,3'R)-4-chloro-3'-hydroxy-4'-methoxyspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | COC1C[C@]2(CNc3ncc(-c4ccc(N)c(C(=O)N(C)C)c4F)c(Cl)c32)C[C@H]1O |
| InChI | InChI=1S/C21H24ClFN4O3/c1-27(2)20(29)15-12(24)5-4-10(18(15)23)11-8-25-19-16(17(11)22)21(9-26-19)6-13(28)14(7-21)30-3/h4-5,8,13-14,28H,6-7,9,24H2,1-3H3,(H,25,26)/t13-,14?,21+/m1/s1 |
| InChIKey | ZEVQYIUGBRGURU-FBVQZCABSA-N |
| XLogP | 2.66 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|