C24H27BrF2N6O5 — CID 175680883
[(3S,4S)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680883) has the molecular formula C24H27BrF2N6O5 and a molecular weight of 597.42 g/mol. Its IUPAC name is [(3S,4S)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3S,4S)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680883 |
| Molecular Formula | C24H27BrF2N6O5 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | [(3S,4S)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2C[C@H](Nc3c(C(=O)N4CCC(F)(F)CC4)cc(Br)cc3[N+](=O)[O-])[C@@H](OC)C2)c1 |
| InChI | InChI=1S/C24H27BrF2N6O5/c1-28-16-7-14(10-29-11-16)22(34)32-12-18(20(13-32)38-2)30-21-17(8-15(25)9-19(21)33(36)37)23(35)31-5-3-24(26,27)4-6-31/h7-11,18,20,28,30H,3-6,12-13H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | FXTQBZOKFADSQZ-ICSRJNTNSA-N |
| XLogP | 3.62 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|