C23H25BrF2N6O6 — CID 175680886
[(3S,4S)-3-[4-bromo-2-(2,2-difluoromorpholine-4-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone (PubChem CID 175680886) has the molecular formula C23H25BrF2N6O6 and a molecular weight of 599.39 g/mol. Its IUPAC name is [(3S,4S)-3-[4-bromo-2-(2,2-difluoromorpholine-4-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone.
| Compound Name | [(3S,4S)-3-[4-bromo-2-(2,2-difluoromorpholine-4-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175680886 |
| Molecular Formula | C23H25BrF2N6O6 |
| Molecular Weight | 599.39 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | [(3S,4S)-3-[4-bromo-2-(2,2-difluoromorpholine-4-carbonyl)-6-nitroanilino]-4-methoxypyrrolidin-1-yl]-[5-(methylamino)-3-pyridinyl]methanone |
| SMILES | CNc1cncc(C(=O)N2C[C@H](Nc3c(C(=O)N4CCOC(F)(F)C4)cc(Br)cc3[N+](=O)[O-])[C@@H](OC)C2)c1 |
| InChI | InChI=1S/C23H25BrF2N6O6/c1-27-15-5-13(8-28-9-15)21(33)31-10-17(19(11-31)37-2)29-20-16(6-14(24)7-18(20)32(35)36)22(34)30-3-4-38-23(25,26)12-30/h5-9,17,19,27,29H,3-4,10-12H2,1-2H3/t17-,19-/m0/s1 |
| InChIKey | WWHYDEVNMIUHBX-HKUYNNGSSA-N |
| XLogP | 2.81 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|