C27H31BrF3N7O6 — CID 175680890
(4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-1-[5-(methylamino)pyridine-3-carbonyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 175680890) has the molecular formula C27H31BrF3N7O6 and a molecular weight of 686.49 g/mol. Its IUPAC name is (4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-1-[5-(methylamino)pyridine-3-carbonyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | (4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-1-[5-(methylamino)pyridine-3-carbonyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 175680890 |
| Molecular Formula | C27H31BrF3N7O6 |
| Molecular Weight | 686.49 g/mol |
| Exact Mass | 685.15 |
| IUPAC Name | (4R)-4-[4-bromo-2-[(2S,6R)-2,6-dimethylmorpholine-4-carbonyl]-6-nitroanilino]-1-[5-(methylamino)pyridine-3-carbonyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | CNc1cncc(C(=O)N2C[C@H](Nc3c(C(=O)N4C[C@@H](C)O[C@@H](C)C4)cc(Br)cc3[N+](=O)[O-])CC2C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C27H31BrF3N7O6/c1-14-10-36(11-15(2)44-14)26(41)20-5-17(28)6-21(38(42)43)23(20)35-19-7-22(24(39)34-13-27(29,30)31)37(12-19)25(40)16-4-18(32-3)9-33-8-16/h4-6,8-9,14-15,19,22,32,35H,7,10-13H2,1-3H3,(H,34,39)/t14-,15+,19-,22?/m1/s1 |
| InChIKey | ILIXLQAUIOBUEN-BZIUPJGESA-N |
| XLogP | 3.42 |
| TPSA | 159.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|