C25H30BrFN6O6 — CID 175680913
[5-bromo-2-[[(3S,4S)-1-[2-fluoro-5-(methylamino)pyridine-3-carbonyl]-4-methoxypyrrolidin-3-yl]amino]-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 175680913) has the molecular formula C25H30BrFN6O6 and a molecular weight of 609.45 g/mol. Its IUPAC name is [5-bromo-2-[[(3S,4S)-1-[2-fluoro-5-(methylamino)pyridine-3-carbonyl]-4-methoxypyrrolidin-3-yl]amino]-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [5-bromo-2-[[(3S,4S)-1-[2-fluoro-5-(methylamino)pyridine-3-carbonyl]-4-methoxypyrrolidin-3-yl]amino]-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 175680913 |
| Molecular Formula | C25H30BrFN6O6 |
| Molecular Weight | 609.45 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | [5-bromo-2-[[(3S,4S)-1-[2-fluoro-5-(methylamino)pyridine-3-carbonyl]-4-methoxypyrrolidin-3-yl]amino]-3-nitrophenyl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | CNc1cnc(F)c(C(=O)N2C[C@H](Nc3c(C(=O)N4C[C@@H](C)O[C@@H](C)C4)cc(Br)cc3[N+](=O)[O-])[C@@H](OC)C2)c1 |
| InChI | InChI=1S/C25H30BrFN6O6/c1-13-9-31(10-14(2)39-13)24(34)17-5-15(26)6-20(33(36)37)22(17)30-19-11-32(12-21(19)38-4)25(35)18-7-16(28-3)8-29-23(18)27/h5-8,13-14,19,21,28,30H,9-12H2,1-4H3/t13-,14+,19-,21-/m0/s1 |
| InChIKey | QZTPZQSFJFIFOC-AAJFEFCHSA-N |
| XLogP | 3.13 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|