About CID 175683781
CID 175683781 (PubChem CID 175683781) has the molecular formula C18H11N3O2
and a molecular weight of 301.31 g/mol.
Molecular Properties
| Compound Name | CID 175683781 |
| PubChem CID | 175683781 |
| Molecular Formula | C18H11N3O2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | — |
| SMILES | [CH2][C]C1(O[CH2])c2ccccc2-c2ccc(C(=O)N=C([N])[N])cc21 |
| InChI | InChI=1S/C18H11N3O2/c1-3-18(23-2)14-7-5-4-6-12(14)13-9-8-11(10-15(13)18)16(22)21-17(19)20/h4-10H,1-2H2 |
| InChIKey | KCQCZDSGNFLKSY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 175683781 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175683781?
The IUPAC name of CID 175683781 (CID 175683781) is not available.
What is the SMILES notation for CID 175683781?
The canonical SMILES for CID 175683781 is [CH2][C]C1(O[CH2])c2ccccc2-c2ccc(C(=O)N=C([N])[N])cc21.
What is the InChIKey of CID 175683781?
The InChIKey is KCQCZDSGNFLKSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N3O2/c1-3-18(23-2)14-7-5-4-6-12(14)13-9-8-11(10-15(13)18)16(22)21-17(19)20/h4-10H,1-2H2.
What are the key properties of CID 175683781?
CID 175683781 has a molecular weight of 301.31 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175683781 is sourced from PubChem (CID 175683781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).