C16H31O5Si- — CID 175684355
4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoate (PubChem CID 175684355) has the molecular formula C16H31O5Si- and a molecular weight of 331.51 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoate.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoate |
|---|---|
| PubChem CID | 175684355 |
| Molecular Formula | C16H31O5Si- |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)CC(CCC(=O)[O-])O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-15(2,3)20-14(19)11-12(9-10-13(17)18)21-22(7,8)16(4,5)6/h12H,9-11H2,1-8H3,(H,17,18)/p-1 |
| InChIKey | UNHPYDFCOZCOBS-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|