About 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one
5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one (PubChem CID 175686987) has the molecular formula C13H14ClF2NO
and a molecular weight of 273.71 g/mol. Its IUPAC name is 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one.
Molecular Properties
| Compound Name | 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one |
| PubChem CID | 175686987 |
| Molecular Formula | C13H14ClF2NO |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(CC(C)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H14ClF2NO/c1-12(7-13(2,15)16)9-6-8(14)4-5-10(9)17(3)11(12)18/h4-6H,7H2,1-3H3 |
| InChIKey | LWAKLKWQIZQVFO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one?
The IUPAC name of 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one (CID 175686987) is 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one.
What is the SMILES notation for 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one?
The canonical SMILES for 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one is CN1C(=O)C(C)(CC(C)(F)F)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one?
The InChIKey is LWAKLKWQIZQVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClF2NO/c1-12(7-13(2,15)16)9-6-8(14)4-5-10(9)17(3)11(12)18/h4-6H,7H2,1-3H3.
What are the key properties of 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one?
5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one has a molecular weight of 273.71 g/mol, XLogP of 3.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(2,2-difluoropropyl)-1,3-dimethylindol-2-one is sourced from PubChem (CID 175686987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).