C15H17F2NO2 — CID 175686992
4-(2,2-difluoropropyl)-2,4,6-trimethylisoquinoline-1,3-dione (PubChem CID 175686992) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-(2,2-difluoropropyl)-2,4,6-trimethylisoquinoline-1,3-dione.
| Compound Name | 4-(2,2-difluoropropyl)-2,4,6-trimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 175686992 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-(2,2-difluoropropyl)-2,4,6-trimethylisoquinoline-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(C)(CC(C)(F)F)C(=O)N(C)C2=O |
| InChI | InChI=1S/C15H17F2NO2/c1-9-5-6-10-11(7-9)14(2,8-15(3,16)17)13(20)18(4)12(10)19/h5-7H,8H2,1-4H3 |
| InChIKey | STJKFZLPGJGTRF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|