About C10H10Cl2Pt
C10H10Cl2Pt (PubChem CID 175687706) has the molecular formula C10H10Cl2Pt
and a molecular weight of 396.17 g/mol.
Molecular Properties
| Compound Name | C10H10Cl2Pt |
| PubChem CID | 175687706 |
| Molecular Formula | C10H10Cl2Pt |
| Molecular Weight | 396.17 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | — |
| SMILES | [C-]1=CC2CC1C1[CH-]C=CC21.[Cl-].[Cl-].[Pt+4] |
| InChI | InChI=1S/C10H10.2ClH.Pt/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-4,7-10H,6H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | RWZWORGWYUIYOP-UHFFFAOYSA-L |
| XLogP | -3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.17 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze C10H10Cl2Pt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of C10H10Cl2Pt?
The IUPAC name of C10H10Cl2Pt (CID 175687706) is not available.
What is the SMILES notation for C10H10Cl2Pt?
The canonical SMILES for C10H10Cl2Pt is [C-]1=CC2CC1C1[CH-]C=CC21.[Cl-].[Cl-].[Pt+4].
What is the InChIKey of C10H10Cl2Pt?
The InChIKey is RWZWORGWYUIYOP-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H10.2ClH.Pt/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-4,7-10H,6H2;2*1H;/q-2;;;+4/p-2.
What are the key properties of C10H10Cl2Pt?
C10H10Cl2Pt has a molecular weight of 396.17 g/mol, XLogP of -3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for C10H10Cl2Pt is sourced from PubChem (CID 175687706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).