C28H40O8 — CID 175688557
bis(prop-2-enyl) cyclohexane-1,1-dicarboxylate;1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 175688557) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is bis(prop-2-enyl) cyclohexane-1,1-dicarboxylate;1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid.
| Compound Name | bis(prop-2-enyl) cyclohexane-1,1-dicarboxylate;1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175688557 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | bis(prop-2-enyl) cyclohexane-1,1-dicarboxylate;1,2-bis(prop-2-enyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=CCC1(C(=O)O)CCCCC1(CC=C)C(=O)O.C=CCOC(=O)C1(C(=O)OCC=C)CCCCC1 |
| InChI | InChI=1S/2C14H20O4/c1-3-10-17-12(15)14(8-6-5-7-9-14)13(16)18-11-4-2;1-3-7-13(11(15)16)9-5-6-10-14(13,8-4-2)12(17)18/h3-4H,1-2,5-11H2;3-4H,1-2,5-10H2,(H,15,16)(H,17,18) |
| InChIKey | QCFZTKUMWGHLPF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|