C4F9NaO3S — CID 175688576
sodium 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonate (PubChem CID 175688576) has the molecular formula C4F9NaO3S and a molecular weight of 322.08 g/mol. Its IUPAC name is sodium 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonate.
| Compound Name | sodium 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonate |
|---|---|
| PubChem CID | 175688576 |
| Molecular Formula | C4F9NaO3S |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | sodium 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(C(F)(F)F)(C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C4HF9O3S.Na/c5-2(6,7)1(3(8,9)10,4(11,12)13)17(14,15)16;/h(H,14,15,16);/q;+1/p-1 |
| InChIKey | IEEJRKZYWQFFDG-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|