About methyl 2-indol-2-ylideneacetate
methyl 2-indol-2-ylideneacetate (PubChem CID 175688695) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is methyl 2-indol-2-ylideneacetate.
Molecular Properties
| Compound Name | methyl 2-indol-2-ylideneacetate |
| PubChem CID | 175688695 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | methyl 2-indol-2-ylideneacetate |
| SMILES | COC(=O)C=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C11H9NO2/c1-14-11(13)7-9-6-8-4-2-3-5-10(8)12-9/h2-7H,1H3 |
| InChIKey | PDZLUUNXMMGRLA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-indol-2-ylideneacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-indol-2-ylideneacetate?
The IUPAC name of methyl 2-indol-2-ylideneacetate (CID 175688695) is methyl 2-indol-2-ylideneacetate.
What is the SMILES notation for methyl 2-indol-2-ylideneacetate?
The canonical SMILES for methyl 2-indol-2-ylideneacetate is COC(=O)C=C1C=c2ccccc2=N1.
What is the InChIKey of methyl 2-indol-2-ylideneacetate?
The InChIKey is PDZLUUNXMMGRLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c1-14-11(13)7-9-6-8-4-2-3-5-10(8)12-9/h2-7H,1H3.
What are the key properties of methyl 2-indol-2-ylideneacetate?
methyl 2-indol-2-ylideneacetate has a molecular weight of 187.20 g/mol, XLogP of 0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-indol-2-ylideneacetate is sourced from PubChem (CID 175688695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).