C11H15F3N2O7S2 — CID 175688956
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid;trifluoromethanesulfonic acid (PubChem CID 175688956) has the molecular formula C11H15F3N2O7S2 and a molecular weight of 408.38 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid;trifluoromethanesulfonic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 175688956 |
| Molecular Formula | C11H15F3N2O7S2 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)Nc1nc(CC(=O)O)cs1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O4S.CHF3O3S/c1-10(2,3)16-9(15)12-8-11-6(5-17-8)4-7(13)14;2-1(3,4)8(5,6)7/h5H,4H2,1-3H3,(H,13,14)(H,11,12,15);(H,5,6,7) |
| InChIKey | ZPSBZGMPIFXINA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|