C8H4F5NOS — CID 175689671
2-(1,1,2,2,2-pentafluoroethyl)-5,6-dihydrothieno[2,3-c]pyrrol-4-one (PubChem CID 175689671) has the molecular formula C8H4F5NOS and a molecular weight of 257.18 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-5,6-dihydrothieno[2,3-c]pyrrol-4-one.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-5,6-dihydrothieno[2,3-c]pyrrol-4-one |
|---|---|
| PubChem CID | 175689671 |
| Molecular Formula | C8H4F5NOS |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-5,6-dihydrothieno[2,3-c]pyrrol-4-one |
| SMILES | O=C1NCc2sc(C(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C8H4F5NOS/c9-7(10,8(11,12)13)5-1-3-4(16-5)2-14-6(3)15/h1H,2H2,(H,14,15) |
| InChIKey | PAQZUSNANXNTLM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|