About CID 175689737
CID 175689737 (PubChem CID 175689737) has the molecular formula C23H15N3OSn
and a molecular weight of 468.10 g/mol.
Molecular Properties
| Compound Name | CID 175689737 |
| PubChem CID | 175689737 |
| Molecular Formula | C23H15N3OSn |
| Molecular Weight | 468.10 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | — |
| SMILES | N#Cc1ccccc1-c1cc(-c2ccccn2)cn(-c2ccccc2)c1=O.[Sn] |
| InChI | InChI=1S/C23H15N3O.Sn/c24-15-17-8-4-5-11-20(17)21-14-18(22-12-6-7-13-25-22)16-26(23(21)27)19-9-2-1-3-10-19;/h1-14,16H; |
| InChIKey | AGIMSBNDCDDERJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.10 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 175689737 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175689737?
The IUPAC name of CID 175689737 (CID 175689737) is not available.
What is the SMILES notation for CID 175689737?
The canonical SMILES for CID 175689737 is N#Cc1ccccc1-c1cc(-c2ccccn2)cn(-c2ccccc2)c1=O.[Sn].
What is the InChIKey of CID 175689737?
The InChIKey is AGIMSBNDCDDERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3O.Sn/c24-15-17-8-4-5-11-20(17)21-14-18(22-12-6-7-13-25-22)16-26(23(21)27)19-9-2-1-3-10-19;/h1-14,16H;.
What are the key properties of CID 175689737?
CID 175689737 has a molecular weight of 468.10 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175689737 is sourced from PubChem (CID 175689737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).